cas: 56782-52-6 — see every product listed under this CAS number, including other names
L-Isoleucine Ethyl Ester Hydrochloride, 97%, 97% (CAS 56782-52-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148MM-25g |
| cas | 56782-52-6 |
| size | 25g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 232.40 Pln | |
| Chemat | 500g | 700.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2S)-2-amino-3-methylpentanoate;hydrochloride (CAS 56782-52-6) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl (2S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: QQGRWNMNWONMOO-JWOPXBRZSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | QQGRWNMNWONMOO-JWOPXBRZSA-N |
| SMILES | CCC(C)[C@@H](C(=O)OCC)N.Cl |
Computed by PubChem (NCBI)