cas: 2577-40-4 — see every product listed under this CAS number, including other names
L-Phenylalanyl-L-phenylalanine, 98%, 98% (CAS 2577-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5X5-100mg |
| cas | 2577-40-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 688.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Phe-Phe is a dipeptide formed from two L-phenylalanine residues. It has a role as a Mycoplasma genitalium metabolite and a human blood serum metabolite. It is functionally related to a L-phenylalanine. It is a tautomer of a Phe-Phe zwitterion.
Source: ChEBI
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | GKZIWHRNKRBEOH-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)N |
Computed by PubChem (NCBI)