cas: 3417-91-2 — see every product listed under this CAS number, including other names
L-Tyrosine methyl ester hydrochloride, 98.00% (CAS 3417-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM38360M-100g |
| cas | 3417-91-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 631.92 Pln | |
| Chemat | 25g | 212.94 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
Methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 3417-91-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: VXYFARNRGZWHTJ-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | VXYFARNRGZWHTJ-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)