cas: 1632032-53-1 — see every product listed under this CAS number, including other names
LB-100, 98%, 98% (CAS 1632032-53-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g, 1mg, 2mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TUJ-10mg |
| cas | 1632032-53-1 |
| size | 10mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 371.60 Pln | |
| Chemat | 50mg | 424.40 Pln | |
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1245.20 Pln | |
| Chemat | 1g | 3256.40 Pln | |
| Chemat | 1mg | 141.20 Pln | |
| Chemat | 2mg | 174.80 Pln | |
| Chemat | 5mg | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1632032-53-1) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: (1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JUQMLSGOTNKJKI-IZUQBHJASA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JUQMLSGOTNKJKI-IZUQBHJASA-N |
| SMILES | CN1CCN(CC1)C(=O)C2[C@@H]3CC[C@H](C2C(=O)O)O3 |
Computed by PubChem (NCBI)