CAS 1185303-00-7 is the registry number for (Mesitylmethylene)malonic acid diammoniate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Azane;2-[(2,4,6-trimethylphenyl)methylidene]propanedioic acid (CAS 1185303-00-7) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: azane;2-[(2,4,6-trimethylphenyl)methylidene]propanedioic acid. InChIKey: DAUCMXFYYAAXRG-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | azane;2-[(2,4,6-trimethylphenyl)methylidene]propanedioic acid |
| InChIKey | DAUCMXFYYAAXRG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C=C(C(=O)O)C(=O)O)C.N.N |
Computed by PubChem (NCBI)