Products 1185303-00-7

CAS 1185303-00-7 is the registry number for (Mesitylmethylene)malonic acid diammoniate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Azane;2-[(2,4,6-trimethylphenyl)methylidene]propanedioic acid (CAS 1185303-00-7) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: azane;2-[(2,4,6-trimethylphenyl)methylidene]propanedioic acid. InChIKey: DAUCMXFYYAAXRG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O4
Molecular weight268.31 g/mol
IUPAC nameazane;2-[(2,4,6-trimethylphenyl)methylidene]propanedioic acid
InChIKeyDAUCMXFYYAAXRG-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)C=C(C(=O)O)C(=O)O)C.N.N

Computed by PubChem (NCBI)