CAS 362703-34-2 appears in our catalog under these names: 1-tert-Butyl 4-methyl 4-cyanopiperidine-1,4-dicarboxylate, 95%, 1–tert–Butyl 4–methyl 4–cyanopiperidine–1,4–dicarboxylate, 1-tert-Butyl 4-methyl 4-cyanopiperidine-1,4-dicarboxylate 97%, 1-tert-Butyl 4-methyl 4-cyanopiperidine-1,4-dicarboxylate, 98%, 98%, Methyl N-Boc-4-cyanopiperidine-4-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
1-O-tert-butyl 4-O-methyl 4-cyanopiperidine-1,4-dicarboxylate (CAS 362703-34-2) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-cyanopiperidine-1,4-dicarboxylate. InChIKey: BNHQNHASKIVGOW-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-cyanopiperidine-1,4-dicarboxylate |
| InChIKey | BNHQNHASKIVGOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C#N)C(=O)OC |
Computed by PubChem (NCBI)