CAS 1632032-53-1 appears in our catalog under these names: LB-100, LB100/ 98.63% (existing batch purity), LB-100 98%, LB-100, 98%, 98%, LB-100, 99.77%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 2mg, 250mg.
(1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1632032-53-1) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: (1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JUQMLSGOTNKJKI-IZUQBHJASA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JUQMLSGOTNKJKI-IZUQBHJASA-N |
| SMILES | CN1CCN(CC1)C(=O)C2[C@@H]3CC[C@H](C2C(=O)O)O3 |
Computed by PubChem (NCBI)