CAS 189622-86-4 is the registry number for tert-Butyl (3-amino-4,5-dimethoxyphenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-amino-4,5-dimethoxyphenyl)carbamate (CAS 189622-86-4) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: tert-butyl N-(3-amino-4,5-dimethoxyphenyl)carbamate. InChIKey: YSVIWEDBKHZPEX-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4,5-dimethoxyphenyl)carbamate |
| InChIKey | YSVIWEDBKHZPEX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C(=C1)OC)OC)N |
Computed by PubChem (NCBI)