LIN28 inhibitor LI71, 98%, 98%
cas: 1357248-83-9 — see every product listed under this CAS number, including other names
LIN28 inhibitor LI71, 98%, 98% (CAS 1357248-83-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KJYZ-1mg |
| cas | 1357248-83-9 |
| size | 1mg |
| availability | 0.5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 371.60 Pln | |
| Chemat | 5mg | 477.20 Pln | |
| Chemat | 10mg | 813.20 Pln | |
| Chemat | 50mg | 2214.80 Pln | |
| Chemat | 100mg | 3304.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[(3aS,4R,9bR)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (CAS 1357248-83-9) is a chemical compound with the molecular formula C21H21NO3 and a molecular weight of 335.4 g/mol. IUPAC name: 4-[(3aS,4R,9bR)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid. InChIKey: QWJMABCFVYELBB-GJYPPUQNSA-N.
| Molecular formula | C21H21NO3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-[(3aS,4R,9bR)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| InChIKey | QWJMABCFVYELBB-GJYPPUQNSA-N |
| SMILES | CCOC1=CC=CC2=C1N[C@H]([C@@H]3[C@H]2C=CC3)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)