Products 1357248-83-9
CAS 1357248-83-9 appears in our catalog under these names: 4-[(3As,4r,9br)-6-ethoxy-3a,4,5,9b-tetrahydro-3h-cyclopenta[c]quinolin-4-yl]benzoic acid, 95%, LIN28 inhibitor LI71/ 95.88% (existing batch purity), LIN28 inhibitor LI71 98%, LIN28 inhibitor LI71, 98%, 98%, LIN28 inhibitor LI71, 98.67%. Offered by: Combi-blocks, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg, 100 mg.
4-[(3aS,4R,9bR)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (CAS 1357248-83-9) is a chemical compound with the molecular formula C21H21NO3 and a molecular weight of 335.4 g/mol. IUPAC name: 4-[(3aS,4R,9bR)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid. InChIKey: QWJMABCFVYELBB-GJYPPUQNSA-N.
| Molecular formula | C21H21NO3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-[(3aS,4R,9bR)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| InChIKey | QWJMABCFVYELBB-GJYPPUQNSA-N |
| SMILES | CCOC1=CC=CC2=C1N[C@H]([C@@H]3[C@H]2C=CC3)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)