CAS 1289575-45-6 appears in our catalog under these names: LSD1-IN-30/ 98.42% (existing batch purity), LSD1–IN–30, LSD1-IN-30, LSD1-IN-30, 99.03%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg.
4-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzamide (CAS 1289575-45-6) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: 4-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzamide. InChIKey: LVGDDYSLMCRYJE-MHWRWJLKSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 4-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzamide |
| InChIKey | LVGDDYSLMCRYJE-MHWRWJLKSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=C(C=C1)O)/C2=CC=CC=C2O |
Computed by PubChem (NCBI)