Products 1346133-08-1
CAS 1346133-08-1 appears in our catalog under these names: LY2795050/ 97.77% (existing batch purity), LY2795050 , LY2795050, Ly2795050, 97.77% ,, 97.77% ,, LY2795050, 98.12%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, 10mM/1mL.
3-chloro-4-[4-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methyl]phenoxy]benzamide (CAS 1346133-08-1) is a chemical compound with the molecular formula C23H22ClN3O2 and a molecular weight of 407.9 g/mol. IUPAC name: 3-chloro-4-[4-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methyl]phenoxy]benzamide. InChIKey: LOOCZNLSXJHWTG-NRFANRHFSA-N.
| Molecular formula | C23H22ClN3O2 |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | 3-chloro-4-[4-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methyl]phenoxy]benzamide |
| InChIKey | LOOCZNLSXJHWTG-NRFANRHFSA-N |
| SMILES | C1C[C@H](N(C1)CC2=CC=C(C=C2)OC3=C(C=C(C=C3)C(=O)N)Cl)C4=CN=CC=C4 |
Computed by PubChem (NCBI)