CAS 2093387-36-9 appears in our catalog under these names: Lenalidomide-Br/ 98.37% (existing batch purity), Lenalidomide–Br, 3-(4-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione, >95.0%(HPLC)(T), 3-(4-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione, Lenalidomide-Br 97%. Offered by: TargetMol, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 200mg, 1g, 25g, 5g, 50g.
3-(7-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2093387-36-9) is a chemical compound with the molecular formula C13H11BrN2O3 and a molecular weight of 323.14 g/mol. IUPAC name: 3-(7-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: SCZFMUWTABGOGF-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O3 |
|---|---|
| Molecular weight | 323.14 g/mol |
| IUPAC name | 3-(7-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | SCZFMUWTABGOGF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3Br |
Computed by PubChem (NCBI)