Products 119425-89-7
CAS 119425-89-7 appears in our catalog under these names: Loureirin A/ 99.84% (existing batch purity), Loureirin A, Loureirin A (Standard), Loureirin A, 99.96%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one (CAS 119425-89-7) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: 3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one. InChIKey: RSAIVLRELNGZEY-UHFFFAOYSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | 3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one |
| InChIKey | RSAIVLRELNGZEY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CCC(=O)C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)