CAS 10205-56-8 appears in our catalog under these names: 4-(1,3-Benzothiazol-2-yl)-n,n-dimethylaniline, 95%, 4-(Benzo(d)thiazol-2-yl)-N,N-dimethylaniline, 95-<97%, 4-(Benzo(d)thiazol-2-yl)-N,N-dimethylaniline, ≥97-<99%, Luciferase-IN-1/ 98.43% (existing batch purity), Luciferase–IN–1. Offered by: Combi-blocks, Hoffman Fine Chemicals, TargetMol, GLPBio, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g, 25g, 50g.
4-(1,3-benzothiazol-2-yl)-N,N-dimethylaniline (CAS 10205-56-8) is a chemical compound with the molecular formula C15H14N2S and a molecular weight of 254.4 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-yl)-N,N-dimethylaniline. InChIKey: HYKGLCSXVAAXNC-UHFFFAOYSA-N.
| Molecular formula | C15H14N2S |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| InChIKey | HYKGLCSXVAAXNC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)