CAS 82351-05-1 appears in our catalog under these names: Lvguidingan, Lvguidingan/ 99.36% (existing batch purity), N-(sec-Butyl)-3-(3,4-dichlorophenyl)acrylamide, 98%, 98%, Lvguidingan, 99.48%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
(E)-N-butan-2-yl-3-(3,4-dichlorophenyl)prop-2-enamide (CAS 82351-05-1) is a chemical compound with the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. IUPAC name: (E)-N-butan-2-yl-3-(3,4-dichlorophenyl)prop-2-enamide. InChIKey: WMHSFCNWWYFBSS-FNORWQNLSA-N.
| Molecular formula | C13H15Cl2NO |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | (E)-N-butan-2-yl-3-(3,4-dichlorophenyl)prop-2-enamide |
| InChIKey | WMHSFCNWWYFBSS-FNORWQNLSA-N |
| SMILES | CCC(C)NC(=O)/C=C/C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)