cas: 3339-45-5 — see every product listed under this CAS number, including other names
METHYL (2S)-4-METHYL-2-(METHYLAMINO)PENTANOATE HYDROCHLORIDE, 96% (CAS 3339-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F849446-1G |
| cas | 3339-45-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 1153.78 Pln | |
| Fluorochem | 25g | 4225.61 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride (CAS 3339-45-5) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride. InChIKey: VKYPGIMVFQAVJF-FJXQXJEOSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride |
| InChIKey | VKYPGIMVFQAVJF-FJXQXJEOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC.Cl |
Computed by PubChem (NCBI)