Methyl N-methyl-L-leucinate hydrochloride, 95%, 95%
cas: 3339-45-5 — see every product listed under this CAS number, including other names
Methyl N-methyl-L-leucinate hydrochloride, 95%, 95% (CAS 3339-45-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJE9-10g |
| cas | 3339-45-5 |
| size | 10g |
| availability | 35.02g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1254.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 25g | 2555.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride (CAS 3339-45-5) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride. InChIKey: VKYPGIMVFQAVJF-FJXQXJEOSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride |
| InChIKey | VKYPGIMVFQAVJF-FJXQXJEOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 4-methyl-2-(methylamino)pentanoate hydrochloride, methyl (2S)-4-methyl-2-(methylamino)pentanoate hydrochloride, Methyl methyl-L-leucinate hydrochloride, Methyl N-methyl-L-leucinate hydrochloride, methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride, N-Me-Leu-OMe.HCl, N-Me-Leu-OMemiddotHCl, Methylmethyl-L-leucinatehydrochloride, (S)-Methyl 4-methyl-2-(methylamino)pentanoate HCl, N-Me-Leu-OMe inverted exclamation mark currencyHCl