cas: 22965-12-4 — see every product listed under this CAS number, including other names
METHYL 10,11-DIHYDRO-5H-DIBENZO[B,F]AZEPINE-4-CARBOXYLATE, 95% (CAS 22965-12-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817767-250MG |
| cas | 22965-12-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6,11-dihydro-5H-benzo[b][1]benzazepine-1-carboxylate (CAS 22965-12-4) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: methyl 6,11-dihydro-5H-benzo[b][1]benzazepine-1-carboxylate. InChIKey: KYPIWWNLKNXWIY-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | methyl 6,11-dihydro-5H-benzo[b][1]benzazepine-1-carboxylate |
| InChIKey | KYPIWWNLKNXWIY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1NC3=CC=CC=C3CC2 |
Computed by PubChem (NCBI)