cas: 1214324-11-4 — see every product listed under this CAS number, including other names
METHYL 2-BROMO-6-TRIFLUOROMETHYLBENZOATE, 98% (CAS 1214324-11-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306913-1G |
| cas | 1214324-11-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 25g | 5766.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-bromo-6-(trifluoromethyl)benzoate (CAS 1214324-11-4) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: methyl 2-bromo-6-(trifluoromethyl)benzoate. InChIKey: CQAHAANYLBWFOP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | methyl 2-bromo-6-(trifluoromethyl)benzoate |
| InChIKey | CQAHAANYLBWFOP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)