cas: 127861-30-7 — see every product listed under this CAS number, including other names
METHYL 2-CHLORO-6-METHOXYPYRIMIDINE-4-CARBOXYLATE, 97%, 97% (CAS 127861-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11A1JI-100mg |
| cas | 127861-30-7 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 870.80 Pln | |
| Chemat | 5g | 2906.00 Pln | |
| Chemat | 10g | 4816.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-chloro-6-methoxypyrimidine-4-carboxylate (CAS 127861-30-7) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: methyl 2-chloro-6-methoxypyrimidine-4-carboxylate. InChIKey: OBFFZLIOVNLYIL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | methyl 2-chloro-6-methoxypyrimidine-4-carboxylate |
| InChIKey | OBFFZLIOVNLYIL-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)