cas: 127861-30-7 — see every product listed under this CAS number, including other names
Methyl 2-chloro-6-methoxypyrimidine-4-carboxylate 95% (CAS 127861-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A486359-250mg |
| cas | 127861-30-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 1110.19 Pln | |
| Ambeed | 5g | 3713.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A486359 |
Methyl 2-chloro-6-methoxypyrimidine-4-carboxylate (CAS 127861-30-7) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: methyl 2-chloro-6-methoxypyrimidine-4-carboxylate. InChIKey: OBFFZLIOVNLYIL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | methyl 2-chloro-6-methoxypyrimidine-4-carboxylate |
| InChIKey | OBFFZLIOVNLYIL-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)