cas: 1508892-33-8 — see every product listed under this CAS number, including other names
METHYL 2-HYDROXY-3-(3-HYDROXYPHENYL)PROPANOATE (CAS 1508892-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387554-100MG |
| cas | 1508892-33-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 5g | 5339.80 Pln | |
| Fluorochem | 10g | 10353.66 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate (CAS 1508892-33-8) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate. InChIKey: AVQQHMWLBBAQQU-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate |
| InChIKey | AVQQHMWLBBAQQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)