cas: 1508892-33-8 — see every product listed under this CAS number, including other names
Methyl 2-Hydroxy-3-(3-hydroxyphenyl)propanoate, >95%, >95% (CAS 1508892-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MWQ-100mg |
| cas | 1508892-33-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 5g | 3237.20 Pln | |
| Chemat | 10g | 6266.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate (CAS 1508892-33-8) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate. InChIKey: AVQQHMWLBBAQQU-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate |
| InChIKey | AVQQHMWLBBAQQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)