cas: 1508892-33-8 — see every product listed under this CAS number, including other names
Methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate 95% (CAS 1508892-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A292160-100mg |
| cas | 1508892-33-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2662.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A292160 |
Methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate (CAS 1508892-33-8) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate. InChIKey: AVQQHMWLBBAQQU-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2-hydroxy-3-(3-hydroxyphenyl)propanoate |
| InChIKey | AVQQHMWLBBAQQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)