cas: 29333-41-3 — see every product listed under this CAS number, including other names
METHYL 3,5-BIS(BROMOMETHYL)BENZOATE, 97% (CAS 29333-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532563-100MG |
| cas | 29333-41-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 1112.13 Pln | |
| Fluorochem | 5g | 3632.07 Pln | |
| Fluorochem | 10g | 6849.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3,5-bis(bromomethyl)benzoate (CAS 29333-41-3) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: methyl 3,5-bis(bromomethyl)benzoate. InChIKey: VKDYWLKLAIJZPL-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | methyl 3,5-bis(bromomethyl)benzoate |
| InChIKey | VKDYWLKLAIJZPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)CBr)CBr |
Computed by PubChem (NCBI)