cas: 1423134-61-5 — see every product listed under this CAS number, including other names
METHYL 3-(BOC-AMINO)-3-(3-HYDROXYPHENYL)PROPANOATE (CAS 1423134-61-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387537-250MG |
| cas | 1423134-61-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 2434.58 Pln | |
| Fluorochem | 5g | 5954.17 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-(3-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1423134-61-5) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl 3-(3-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ZMTYKJJOKXHQAL-UHFFFAOYSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl 3-(3-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ZMTYKJJOKXHQAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OC)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)