cas: 205114-17-6 — see every product listed under this CAS number, including other names
METHYL 3-BROMOQUINOLINE-6-CARBOXYLATE, 97% (CAS 205114-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F466946-100MG |
| cas | 205114-17-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 607.10 Pln | |
| Fluorochem | 10g | 1158.98 Pln | |
| Fluorochem | 25g | 2262.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-bromoquinoline-6-carboxylate (CAS 205114-17-6) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: methyl 3-bromoquinoline-6-carboxylate. InChIKey: IQKJYNVCQVDCOU-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | methyl 3-bromoquinoline-6-carboxylate |
| InChIKey | IQKJYNVCQVDCOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CN=C2C=C1)Br |
Computed by PubChem (NCBI)