cas: 205114-17-6 — see every product listed under this CAS number, including other names
Methyl 3-bromoquinoline-6-carboxylate, 98%, 98% (CAS 205114-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130VE-100g |
| cas | 205114-17-6 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5296.40 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 25g | 1696.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromoquinoline-6-carboxylate (CAS 205114-17-6) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: methyl 3-bromoquinoline-6-carboxylate. InChIKey: IQKJYNVCQVDCOU-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | methyl 3-bromoquinoline-6-carboxylate |
| InChIKey | IQKJYNVCQVDCOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CN=C2C=C1)Br |
Computed by PubChem (NCBI)