CAS 1333251-88-9 appears in our catalog under these names: 8-Bromo-2-methylquinoline-3-carboxylic acid, 95%, 8-Bromo-2-methylquinoline-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
8-bromo-2-methylquinoline-3-carboxylic acid (CAS 1333251-88-9) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 8-bromo-2-methylquinoline-3-carboxylic acid. InChIKey: SMCHLZKCDHYUEL-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 8-bromo-2-methylquinoline-3-carboxylic acid |
| InChIKey | SMCHLZKCDHYUEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=CC=C(C2=N1)Br)C(=O)O |
Computed by PubChem (NCBI)