cas: 205114-17-6 — see every product listed under this CAS number, including other names
Methyl 3-bromoquinoline-6-carboxylate 98% (CAS 205114-17-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A759936-250mg |
| cas | 205114-17-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 748.62 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A759936 |
Methyl 3-bromoquinoline-6-carboxylate (CAS 205114-17-6) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: methyl 3-bromoquinoline-6-carboxylate. InChIKey: IQKJYNVCQVDCOU-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | methyl 3-bromoquinoline-6-carboxylate |
| InChIKey | IQKJYNVCQVDCOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CN=C2C=C1)Br |
Computed by PubChem (NCBI)