Products 1296950-68-9

CAS 1296950-68-9 is the registry number for 8-Bromo-6-methylquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

8-bromo-6-methylquinoline-3-carboxylic acid (CAS 1296950-68-9) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 8-bromo-6-methylquinoline-3-carboxylic acid. InChIKey: DZBCQPBAPWTCCE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8BrNO2
Molecular weight266.09 g/mol
IUPAC name8-bromo-6-methylquinoline-3-carboxylic acid
InChIKeyDZBCQPBAPWTCCE-UHFFFAOYSA-N
SMILESCC1=CC2=CC(=CN=C2C(=C1)Br)C(=O)O

Computed by PubChem (NCBI)