cas: 1142224-62-1 — see every product listed under this CAS number, including other names
METHYL 3-CYCLOPROPYL-3-(3-HYDROXYPHENYL)PROPANOATE (CAS 1142224-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387479-100MG |
| cas | 1142224-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1049.65 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 2950.02 Pln | |
| Fluorochem | 5g | 6766.39 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate (CAS 1142224-62-1) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. InChIKey: PXBFBXFVUPMAJK-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
| InChIKey | PXBFBXFVUPMAJK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1CC1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)