cas: 1355729-56-4 — see every product listed under this CAS number, including other names
METHYL 4-(DIFLUOROMETHYL)PYRIMIDINE-2-CARBOXYLATE, 97%, 97% (CAS 1355729-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPIN-100mg |
| cas | 1355729-56-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1432.40 Pln | |
| Chemat | 5g | 4917.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(difluoromethyl)pyrimidine-2-carboxylate (CAS 1355729-56-4) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 4-(difluoromethyl)pyrimidine-2-carboxylate. InChIKey: ZHYSCSBYNOJUTN-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 4-(difluoromethyl)pyrimidine-2-carboxylate |
| InChIKey | ZHYSCSBYNOJUTN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=N1)C(F)F |
Computed by PubChem (NCBI)