CAS 112822-77-2 appears in our catalog under these names: 2,4-Difluoro-3-methyl-5-nitrobenzenamine, 95%, 2,4-Difluoro-3-methyl-5-nitroaniline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2,4-difluoro-3-methyl-5-nitroaniline (CAS 112822-77-2) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 2,4-difluoro-3-methyl-5-nitroaniline. InChIKey: IYZXBTUPJKIQIL-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,4-difluoro-3-methyl-5-nitroaniline |
| InChIKey | IYZXBTUPJKIQIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)[N+](=O)[O-])N)F |
Computed by PubChem (NCBI)