CAS 1565712-50-6 is the registry number for 2-(2,2-Difluoroethoxy)pyrimidine-5-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
2-(2,2-difluoroethoxy)pyrimidine-5-carbaldehyde (CAS 1565712-50-6) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)pyrimidine-5-carbaldehyde. InChIKey: YGXNVYRYPBDKPA-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)pyrimidine-5-carbaldehyde |
| InChIKey | YGXNVYRYPBDKPA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OCC(F)F)C=O |
Computed by PubChem (NCBI)