CAS 2803703-94-6 is the registry number for Methyl 2-amino-3,5-difluoroisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-amino-3,5-difluoropyridine-4-carboxylate (CAS 2803703-94-6) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2-amino-3,5-difluoropyridine-4-carboxylate. InChIKey: ITPCCKYLLGVCPL-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2-amino-3,5-difluoropyridine-4-carboxylate |
| InChIKey | ITPCCKYLLGVCPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1F)N)F |
Computed by PubChem (NCBI)