Products 2803703-94-6

CAS 2803703-94-6 is the registry number for Methyl 2-amino-3,5-difluoroisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 2-amino-3,5-difluoropyridine-4-carboxylate (CAS 2803703-94-6) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2-amino-3,5-difluoropyridine-4-carboxylate. InChIKey: ITPCCKYLLGVCPL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F2N2O2
Molecular weight188.13 g/mol
IUPAC namemethyl 2-amino-3,5-difluoropyridine-4-carboxylate
InChIKeyITPCCKYLLGVCPL-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=NC=C1F)N)F

Computed by PubChem (NCBI)