Products 170432-54-9
CAS 170432-54-9 is the registry number for 2,3-Difluoro-N-methyl-6-nitroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
2,3-difluoro-N-methyl-6-nitroaniline (CAS 170432-54-9) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 2,3-difluoro-N-methyl-6-nitroaniline. InChIKey: QTMMIYSDZZPQFA-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,3-difluoro-N-methyl-6-nitroaniline |
| InChIKey | QTMMIYSDZZPQFA-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)