cas: 1788041-64-4 — see every product listed under this CAS number, including other names
METHYL 5-BROMO-2,3-DIHYDRO-1H-INDOLE-6-CARBOXYLATE, 97% (CAS 1788041-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504768-100MG |
| cas | 1788041-64-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 971.55 Pln | |
| Fluorochem | 250mg | 1565.09 Pln | |
| Fluorochem | 500mg | 2221.11 Pln | |
| Fluorochem | 1g | 3267.62 Pln | |
| Fluorochem | 5g | 9661.20 Pln | |
| Fluorochem | 10g | 16054.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-bromo-2,3-dihydro-1H-indole-6-carboxylate (CAS 1788041-64-4) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: methyl 5-bromo-2,3-dihydro-1H-indole-6-carboxylate. InChIKey: FLMKDSGWXSOCJZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | methyl 5-bromo-2,3-dihydro-1H-indole-6-carboxylate |
| InChIKey | FLMKDSGWXSOCJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2CCNC2=C1)Br |
Computed by PubChem (NCBI)