Products 694488-83-0
CAS 694488-83-0 appears in our catalog under these names: MFI8/ 99.78% (existing batch purity), MFI8, MFI8 99%, MFI8, 99%, 99%, MFI8, 99.67%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g.
4-chloro-2-[1-(2,3-dimethylanilino)ethyl]phenol (CAS 694488-83-0) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 4-chloro-2-[1-(2,3-dimethylanilino)ethyl]phenol. InChIKey: DYILWFVSLLZIIR-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 4-chloro-2-[1-(2,3-dimethylanilino)ethyl]phenol |
| InChIKey | DYILWFVSLLZIIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(C)C2=C(C=CC(=C2)Cl)O)C |
Computed by PubChem (NCBI)