CAS 1646499-97-9 appears in our catalog under these names: ML 382, ML382/ 99.71% (existing batch purity), ML 382, ML382 98+%, 2-(Cyclopropanesulfonamido)-N-(2-ethoxyphenyl)benzamide, 98+%, 98+%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 100mg, 200mg.
2-(cyclopropylsulfonylamino)-N-(2-ethoxyphenyl)benzamide (CAS 1646499-97-9) is a chemical compound with the molecular formula C18H20N2O4S and a molecular weight of 360.4 g/mol. IUPAC name: 2-(cyclopropylsulfonylamino)-N-(2-ethoxyphenyl)benzamide. InChIKey: RCSLEKLNDJJJLF-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2-(cyclopropylsulfonylamino)-N-(2-ethoxyphenyl)benzamide |
| InChIKey | RCSLEKLNDJJJLF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1NC(=O)C2=CC=CC=C2NS(=O)(=O)C3CC3 |
Computed by PubChem (NCBI)