Products 140636-22-2
CAS 140636-22-2 is the registry number for Mianserin hydrochloride Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-17-yl) hydrogen sulfate (CAS 140636-22-2) is a chemical compound with the molecular formula C18H20N2O4S and a molecular weight of 360.4 g/mol. IUPAC name: (5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-17-yl) hydrogen sulfate. InChIKey: QCYUBDSPJCVVQB-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-17-yl) hydrogen sulfate |
| InChIKey | QCYUBDSPJCVVQB-UHFFFAOYSA-N |
| SMILES | CN1CCN2C(C1)C3=CC=CC=C3CC4=C2C=CC(=C4)OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Mianserin Hydrochloride Impurity 7