CAS 1313712-37-6 appears in our catalog under these names: 2-Amino-4,7-dihydro-5h-thieno[2,3-c]pyridine-3,6-dicarboxylic acid 6-benzyl ester 3-ethyl ester, 95%, 2-Amino-4,7-dihydro-5H-thieno[2,3-c]pyridine-3,6-dicarboxylic acid 6-benzyl ester 3-ethyl ester, 97%, 97%, 6-O-benzyl 3-O-ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
6-O-benzyl 3-O-ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (CAS 1313712-37-6) is a chemical compound with the molecular formula C18H20N2O4S and a molecular weight of 360.4 g/mol. IUPAC name: 6-O-benzyl 3-O-ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate. InChIKey: LSHGRHDWNSSUTG-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 6-O-benzyl 3-O-ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| InChIKey | LSHGRHDWNSSUTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCN(C2)C(=O)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)