CAS 147086-11-1 is the registry number for Mianserin hydrochloride Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
[(7S)-5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-17-yl] hydrogen sulfate (CAS 147086-11-1) is a chemical compound with the molecular formula C18H20N2O4S and a molecular weight of 360.4 g/mol. IUPAC name: [(7S)-5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-17-yl] hydrogen sulfate. InChIKey: QCYUBDSPJCVVQB-GOSISDBHSA-N.
| Molecular formula | C18H20N2O4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | [(7S)-5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-17-yl] hydrogen sulfate |
| InChIKey | QCYUBDSPJCVVQB-GOSISDBHSA-N |
| SMILES | CN1CCN2[C@H](C1)C3=CC=CC=C3CC4=C2C=CC(=C4)OS(=O)(=O)O |
Computed by PubChem (NCBI)