CAS 298684-44-3 appears in our catalog under these names: ML402/ 98.93% (existing batch purity), ML402, ML402, 99.71% ,, 99.71% ,, ML402, 99.42%, 2-Thiophenecarboxamide, N-[2-(4-chloro-2-methylphenoxy)ethyl]-, ≥98%(HPLC). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso).
N-[2-(4-chloro-2-methylphenoxy)ethyl]thiophene-2-carboxamide (CAS 298684-44-3) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: N-[2-(4-chloro-2-methylphenoxy)ethyl]thiophene-2-carboxamide. InChIKey: RULQUKFOBAPKKR-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | N-[2-(4-chloro-2-methylphenoxy)ethyl]thiophene-2-carboxamide |
| InChIKey | RULQUKFOBAPKKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OCCNC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)