CAS 352553-42-5 appears in our catalog under these names: MS7972, MS7972/ 99.84% (existing batch purity), MS7972, 98%, 98%, MS7972, 99.81%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 1mg, 50mg, 100mg, 200mg, 25 mg.
9-acetyl-3,4-dihydro-2H-carbazol-1-one (CAS 352553-42-5) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 9-acetyl-3,4-dihydro-2H-carbazol-1-one. InChIKey: MIGJEXKBUJPKJF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 9-acetyl-3,4-dihydro-2H-carbazol-1-one |
| InChIKey | MIGJEXKBUJPKJF-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2C3=C1C(=O)CCC3 |
Computed by PubChem (NCBI)