Products 129425-81-6
CAS 129425-81-6 appears in our catalog under these names: MSA–2, MSA-2/ 98.19% (existing batch purity), MSA-2, MSA-2 98%, 4-(5,6-dimethoxybenzo[b]thiophen-2-yl)-4-oxobutanoic acid, 98%, 98%. Offered by: GLPBio, TargetMol, Chemat, Ambeed, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 2mg, 25mg, 50mg, 100mg.
4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid (CAS 129425-81-6) is a chemical compound with the molecular formula C14H14O5S and a molecular weight of 294.32 g/mol. IUPAC name: 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid. InChIKey: APCLRHPWFCQIMG-UHFFFAOYSA-N.
| Molecular formula | C14H14O5S |
|---|---|
| Molecular weight | 294.32 g/mol |
| IUPAC name | 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid |
| InChIKey | APCLRHPWFCQIMG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(S2)C(=O)CCC(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid, 4-(5,6-dimethoxybenzo[b]thiophen-2-yl)-4-oxobutanoic acid, s9681, 4-(5,6-dimethoxy-benzo[b]thien-2-yl)-4-oxo-butanoic acid, 4-(5,6-dimethoxybenzo[b]thiophen-2-yl)-4- oxobutanoic acid, orb1220269, orb1298624, compound 62 [PMID: 31820978], example 16 [WO2018067423A1], 4-(5,6-Dimethoxy-2-benzothienyl)-4-oxobutanoic Acid