cas: 1374666-32-6 — see every product listed under this CAS number, including other names
Mal-PEG2-acid 95% (CAS 1374666-32-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750400-100mg |
| cas | 1374666-32-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 798.69 Pln | |
| Ambeed | 5g | 2567.56 Pln | |
| Ambeed | 10g | 4169.56 Pln | |
| Ambeed | 25g | 8258.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A750400 |
3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid (CAS 1374666-32-6) is a chemical compound with the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. IUPAC name: 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid. InChIKey: TXMDOUPVKVGPIS-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid |
| InChIKey | TXMDOUPVKVGPIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCC(=O)O |
Computed by PubChem (NCBI)