cas: 1374666-32-6 — see every product listed under this CAS number, including other names
Mal-PEG2-acid (CAS 1374666-32-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T15978-5mg |
| cas | 1374666-32-6 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 386.15 Pln | |
| TargetMol | 10mg | 445.96 Pln | |
| TargetMol | 25mg | 578.44 Pln | |
| TargetMol | 50mg | 797.57 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid (CAS 1374666-32-6) is a chemical compound with the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. IUPAC name: 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid. InChIKey: TXMDOUPVKVGPIS-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid |
| InChIKey | TXMDOUPVKVGPIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCC(=O)O |
Computed by PubChem (NCBI)