cas: 1374666-32-6 — see every product listed under this CAS number, including other names
Mal-PEG2-acid, >95.0%(T) (CAS 1374666-32-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3203-250MG |
| cas | 1374666-32-6 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 355.86 Pln | |
| TCI | 1g | 778.75 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid (CAS 1374666-32-6) is a chemical compound with the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. IUPAC name: 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid. InChIKey: TXMDOUPVKVGPIS-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid |
| InChIKey | TXMDOUPVKVGPIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCC(=O)O |
Computed by PubChem (NCBI)